C11H9F3N4O2S — CID 113051513
N-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]methanesulfonamide (PubChem CID 113051513) has the molecular formula C11H9F3N4O2S and a molecular weight of 318.28 g/mol. Its IUPAC name is N-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]methanesulfonamide.
| Compound Name | N-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 113051513 |
| Molecular Formula | C11H9F3N4O2S |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | N-[6-(2,3,4-trifluoroanilino)pyridazin-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(Nc2ccc(F)c(F)c2F)nn1 |
| InChI | InChI=1S/C11H9F3N4O2S/c1-21(19,20)18-9-5-4-8(16-17-9)15-7-3-2-6(12)10(13)11(7)14/h2-5H,1H3,(H,15,16)(H,17,18) |
| InChIKey | BBFRWJNIESYQFI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|