C15H20N4O2S — CID 113047098
N-[6-(2-tert-butylanilino)pyridazin-3-yl]methanesulfonamide (PubChem CID 113047098) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is N-[6-(2-tert-butylanilino)pyridazin-3-yl]methanesulfonamide.
| Compound Name | N-[6-(2-tert-butylanilino)pyridazin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 113047098 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-[6-(2-tert-butylanilino)pyridazin-3-yl]methanesulfonamide |
| SMILES | CC(C)(C)c1ccccc1Nc1ccc(NS(C)(=O)=O)nn1 |
| InChI | InChI=1S/C15H20N4O2S/c1-15(2,3)11-7-5-6-8-12(11)16-13-9-10-14(18-17-13)19-22(4,20)21/h5-10H,1-4H3,(H,16,17)(H,18,19) |
| InChIKey | LMHIWHLEZFHYQN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |