C18H22N4O — CID 109110491
6-(2-tert-butylanilino)-N-prop-2-enylpyridazine-3-carboxamide (PubChem CID 109110491) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 6-(2-tert-butylanilino)-N-prop-2-enylpyridazine-3-carboxamide.
| Compound Name | 6-(2-tert-butylanilino)-N-prop-2-enylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109110491 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 6-(2-tert-butylanilino)-N-prop-2-enylpyridazine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(Nc2ccccc2C(C)(C)C)nn1 |
| InChI | InChI=1S/C18H22N4O/c1-5-12-19-17(23)15-10-11-16(22-21-15)20-14-9-7-6-8-13(14)18(2,3)4/h5-11H,1,12H2,2-4H3,(H,19,23)(H,20,22) |
| InChIKey | APJXICNIPLORES-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|