C21H24N2O2 — CID 109043561
4-N-(2-tert-butylphenyl)-1-N-prop-2-enylbenzene-1,4-dicarboxamide (PubChem CID 109043561) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-N-(2-tert-butylphenyl)-1-N-prop-2-enylbenzene-1,4-dicarboxamide.
| Compound Name | 4-N-(2-tert-butylphenyl)-1-N-prop-2-enylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109043561 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 4-N-(2-tert-butylphenyl)-1-N-prop-2-enylbenzene-1,4-dicarboxamide |
| SMILES | C=CCNC(=O)c1ccc(C(=O)Nc2ccccc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C21H24N2O2/c1-5-14-22-19(24)15-10-12-16(13-11-15)20(25)23-18-9-7-6-8-17(18)21(2,3)4/h5-13H,1,14H2,2-4H3,(H,22,24)(H,23,25) |
| InChIKey | RADKTTVHKRWOKE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|