C20H26N4O — CID 109110549
6-[2,6-di(propan-2-yl)anilino]-N-prop-2-enylpyridazine-3-carboxamide (PubChem CID 109110549) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 6-[2,6-di(propan-2-yl)anilino]-N-prop-2-enylpyridazine-3-carboxamide.
| Compound Name | 6-[2,6-di(propan-2-yl)anilino]-N-prop-2-enylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109110549 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 6-[2,6-di(propan-2-yl)anilino]-N-prop-2-enylpyridazine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(Nc2c(C(C)C)cccc2C(C)C)nn1 |
| InChI | InChI=1S/C20H26N4O/c1-6-12-21-20(25)17-10-11-18(24-23-17)22-19-15(13(2)3)8-7-9-16(19)14(4)5/h6-11,13-14H,1,12H2,2-5H3,(H,21,25)(H,22,24) |
| InChIKey | AWIZWYXCEYCGAL-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|