C13H11F3N4O — CID 113048912
N-[6-[2-(trifluoromethyl)anilino]pyridazin-3-yl]acetamide (PubChem CID 113048912) has the molecular formula C13H11F3N4O and a molecular weight of 296.25 g/mol. Its IUPAC name is N-[6-[2-(trifluoromethyl)anilino]pyridazin-3-yl]acetamide.
| Compound Name | N-[6-[2-(trifluoromethyl)anilino]pyridazin-3-yl]acetamide |
|---|---|
| PubChem CID | 113048912 |
| Molecular Formula | C13H11F3N4O |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-[6-[2-(trifluoromethyl)anilino]pyridazin-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2ccccc2C(F)(F)F)nn1 |
| InChI | InChI=1S/C13H11F3N4O/c1-8(21)17-11-6-7-12(20-19-11)18-10-5-3-2-4-9(10)13(14,15)16/h2-7H,1H3,(H,18,20)(H,17,19,21) |
| InChIKey | GRTIOBDGJQXDMQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |