C16H15F3N4O2 — CID 109114740
morpholin-4-yl-[6-[2-(trifluoromethyl)anilino]pyridazin-3-yl]methanone (PubChem CID 109114740) has the molecular formula C16H15F3N4O2 and a molecular weight of 352.32 g/mol. Its IUPAC name is morpholin-4-yl-[6-[2-(trifluoromethyl)anilino]pyridazin-3-yl]methanone.
| Compound Name | morpholin-4-yl-[6-[2-(trifluoromethyl)anilino]pyridazin-3-yl]methanone |
|---|---|
| PubChem CID | 109114740 |
| Molecular Formula | C16H15F3N4O2 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | morpholin-4-yl-[6-[2-(trifluoromethyl)anilino]pyridazin-3-yl]methanone |
| SMILES | O=C(c1ccc(Nc2ccccc2C(F)(F)F)nn1)N1CCOCC1 |
| InChI | InChI=1S/C16H15F3N4O2/c17-16(18,19)11-3-1-2-4-12(11)20-14-6-5-13(21-22-14)15(24)23-7-9-25-10-8-23/h1-6H,7-10H2,(H,20,22) |
| InChIKey | CJJMHRFUHRWKNS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |