C15H14F2N4O2 — CID 109114795
[6-(3,4-difluoroanilino)pyridazin-3-yl]-morpholin-4-ylmethanone (PubChem CID 109114795) has the molecular formula C15H14F2N4O2 and a molecular weight of 320.30 g/mol. Its IUPAC name is [6-(3,4-difluoroanilino)pyridazin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [6-(3,4-difluoroanilino)pyridazin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 109114795 |
| Molecular Formula | C15H14F2N4O2 |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | [6-(3,4-difluoroanilino)pyridazin-3-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1ccc(Nc2ccc(F)c(F)c2)nn1)N1CCOCC1 |
| InChI | InChI=1S/C15H14F2N4O2/c16-11-2-1-10(9-12(11)17)18-14-4-3-13(19-20-14)15(22)21-5-7-23-8-6-21/h1-4,9H,5-8H2,(H,18,20) |
| InChIKey | BZFBWRYAJJIFQF-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |