C10H14N4O2 — CID 62172695
[6-(methylamino)pyridazin-3-yl]-morpholin-4-ylmethanone (PubChem CID 62172695) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is [6-(methylamino)pyridazin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [6-(methylamino)pyridazin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 62172695 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | [6-(methylamino)pyridazin-3-yl]-morpholin-4-ylmethanone |
| SMILES | CNc1ccc(C(=O)N2CCOCC2)nn1 |
| InChI | InChI=1S/C10H14N4O2/c1-11-9-3-2-8(12-13-9)10(15)14-4-6-16-7-5-14/h2-3H,4-7H2,1H3,(H,11,13) |
| InChIKey | CEWQWFDWOQKPIF-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |