C10H12ClN3O2 — CID 62974873
(6-chloropyridazin-3-yl)-(1,4-oxazepan-4-yl)methanone (PubChem CID 62974873) has the molecular formula C10H12ClN3O2 and a molecular weight of 241.68 g/mol. Its IUPAC name is (6-chloropyridazin-3-yl)-(1,4-oxazepan-4-yl)methanone.
| Compound Name | (6-chloropyridazin-3-yl)-(1,4-oxazepan-4-yl)methanone |
|---|---|
| PubChem CID | 62974873 |
| Molecular Formula | C10H12ClN3O2 |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | (6-chloropyridazin-3-yl)-(1,4-oxazepan-4-yl)methanone |
| SMILES | O=C(c1ccc(Cl)nn1)N1CCCOCC1 |
| InChI | InChI=1S/C10H12ClN3O2/c11-9-3-2-8(12-13-9)10(15)14-4-1-6-16-7-5-14/h2-3H,1,4-7H2 |
| InChIKey | KIQIFNPFLDFIQI-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |