C10H13ClN4O3S — CID 61042497
(6-chloropyridazin-3-yl)-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 61042497) has the molecular formula C10H13ClN4O3S and a molecular weight of 304.76 g/mol. Its IUPAC name is (6-chloropyridazin-3-yl)-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | (6-chloropyridazin-3-yl)-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 61042497 |
| Molecular Formula | C10H13ClN4O3S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (6-chloropyridazin-3-yl)-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)c2ccc(Cl)nn2)CC1 |
| InChI | InChI=1S/C10H13ClN4O3S/c1-19(17,18)15-6-4-14(5-7-15)10(16)8-2-3-9(11)13-12-8/h2-3H,4-7H2,1H3 |
| InChIKey | UELHOSLDTJVIAS-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |