C11H17N5O3S — CID 62992096
[6-(methylamino)pyridazin-3-yl]-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 62992096) has the molecular formula C11H17N5O3S and a molecular weight of 299.36 g/mol. Its IUPAC name is [6-(methylamino)pyridazin-3-yl]-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [6-(methylamino)pyridazin-3-yl]-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 62992096 |
| Molecular Formula | C11H17N5O3S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | [6-(methylamino)pyridazin-3-yl]-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | CNc1ccc(C(=O)N2CCN(S(C)(=O)=O)CC2)nn1 |
| InChI | InChI=1S/C11H17N5O3S/c1-12-10-4-3-9(13-14-10)11(17)15-5-7-16(8-6-15)20(2,18)19/h3-4H,5-8H2,1-2H3,(H,12,14) |
| InChIKey | UHMVQRDEWKWXCU-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |