C13H20N4O3S — CID 81237800
[6-methyl-4-(methylamino)-3-pyridinyl]-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 81237800) has the molecular formula C13H20N4O3S and a molecular weight of 312.39 g/mol. Its IUPAC name is [6-methyl-4-(methylamino)-3-pyridinyl]-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [6-methyl-4-(methylamino)-3-pyridinyl]-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 81237800 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | [6-methyl-4-(methylamino)-3-pyridinyl]-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | CNc1cc(C)ncc1C(=O)N1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H20N4O3S/c1-10-8-12(14-2)11(9-15-10)13(18)16-4-6-17(7-5-16)21(3,19)20/h8-9H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | PLMQPIGHKMELHH-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |