C13H11F3N4O2 — CID 113048941
methyl N-[6-[2-(trifluoromethyl)anilino]pyridazin-3-yl]carbamate (PubChem CID 113048941) has the molecular formula C13H11F3N4O2 and a molecular weight of 312.25 g/mol. Its IUPAC name is methyl N-[6-[2-(trifluoromethyl)anilino]pyridazin-3-yl]carbamate.
| Compound Name | methyl N-[6-[2-(trifluoromethyl)anilino]pyridazin-3-yl]carbamate |
|---|---|
| PubChem CID | 113048941 |
| Molecular Formula | C13H11F3N4O2 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | methyl N-[6-[2-(trifluoromethyl)anilino]pyridazin-3-yl]carbamate |
| SMILES | COC(=O)Nc1ccc(Nc2ccccc2C(F)(F)F)nn1 |
| InChI | InChI=1S/C13H11F3N4O2/c1-22-12(21)18-11-7-6-10(19-20-11)17-9-5-3-2-4-8(9)13(14,15)16/h2-7H,1H3,(H,17,19)(H,18,20,21) |
| InChIKey | HJTJUEFIRJOOCY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |