C19H26N4O3 — CID 113043351
N-[6-[(3,4-dimethoxyphenyl)methylamino]pyridazin-3-yl]-2-ethylbutanamide (PubChem CID 113043351) has the molecular formula C19H26N4O3 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[6-[(3,4-dimethoxyphenyl)methylamino]pyridazin-3-yl]-2-ethylbutanamide.
| Compound Name | N-[6-[(3,4-dimethoxyphenyl)methylamino]pyridazin-3-yl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 113043351 |
| Molecular Formula | C19H26N4O3 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | N-[6-[(3,4-dimethoxyphenyl)methylamino]pyridazin-3-yl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(NCc2ccc(OC)c(OC)c2)nn1 |
| InChI | InChI=1S/C19H26N4O3/c1-5-14(6-2)19(24)21-18-10-9-17(22-23-18)20-12-13-7-8-15(25-3)16(11-13)26-4/h7-11,14H,5-6,12H2,1-4H3,(H,20,22)(H,21,23,24) |
| InChIKey | IBTSVSOPQDLZDU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |