C17H21N3O4 — CID 113014023
ethyl N-[6-[(3,4-dimethoxyphenyl)methylamino]-3-pyridinyl]carbamate (PubChem CID 113014023) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is ethyl N-[6-[(3,4-dimethoxyphenyl)methylamino]-3-pyridinyl]carbamate.
| Compound Name | ethyl N-[6-[(3,4-dimethoxyphenyl)methylamino]-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 113014023 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | ethyl N-[6-[(3,4-dimethoxyphenyl)methylamino]-3-pyridinyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccc(OC)c(OC)c2)nc1 |
| InChI | InChI=1S/C17H21N3O4/c1-4-24-17(21)20-13-6-8-16(19-11-13)18-10-12-5-7-14(22-2)15(9-12)23-3/h5-9,11H,4,10H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | IVWIXGBZTQFGFI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |