C17H21N5O3 — CID 113043387
1-cyclopropyl-3-[6-[(3,4-dimethoxyphenyl)methylamino]pyridazin-3-yl]urea (PubChem CID 113043387) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-cyclopropyl-3-[6-[(3,4-dimethoxyphenyl)methylamino]pyridazin-3-yl]urea.
| Compound Name | 1-cyclopropyl-3-[6-[(3,4-dimethoxyphenyl)methylamino]pyridazin-3-yl]urea |
|---|---|
| PubChem CID | 113043387 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-cyclopropyl-3-[6-[(3,4-dimethoxyphenyl)methylamino]pyridazin-3-yl]urea |
| SMILES | COc1ccc(CNc2ccc(NC(=O)NC3CC3)nn2)cc1OC |
| InChI | InChI=1S/C17H21N5O3/c1-24-13-6-3-11(9-14(13)25-2)10-18-15-7-8-16(22-21-15)20-17(23)19-12-4-5-12/h3,6-9,12H,4-5,10H2,1-2H3,(H,18,21)(H2,19,20,22,23) |
| InChIKey | URFSQUZEESZRCH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |