C21H28N4O3 — CID 109285915
N-cycloheptyl-5-[(3,4-dimethoxyphenyl)methylamino]pyrazine-2-carboxamide (PubChem CID 109285915) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-cycloheptyl-5-[(3,4-dimethoxyphenyl)methylamino]pyrazine-2-carboxamide.
| Compound Name | N-cycloheptyl-5-[(3,4-dimethoxyphenyl)methylamino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109285915 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-cycloheptyl-5-[(3,4-dimethoxyphenyl)methylamino]pyrazine-2-carboxamide |
| SMILES | COc1ccc(CNc2cnc(C(=O)NC3CCCCCC3)cn2)cc1OC |
| InChI | InChI=1S/C21H28N4O3/c1-27-18-10-9-15(11-19(18)28-2)12-23-20-14-22-17(13-24-20)21(26)25-16-7-5-3-4-6-8-16/h9-11,13-14,16H,3-8,12H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | LHDUNDPPFIGTPJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |