C22H29N3O3 — CID 109182948
N-cyclohexyl-5-[2-(3,4-dimethoxyphenyl)ethylamino]pyridine-2-carboxamide (PubChem CID 109182948) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is N-cyclohexyl-5-[2-(3,4-dimethoxyphenyl)ethylamino]pyridine-2-carboxamide.
| Compound Name | N-cyclohexyl-5-[2-(3,4-dimethoxyphenyl)ethylamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 109182948 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | N-cyclohexyl-5-[2-(3,4-dimethoxyphenyl)ethylamino]pyridine-2-carboxamide |
| SMILES | COc1ccc(CCNc2ccc(C(=O)NC3CCCCC3)nc2)cc1OC |
| InChI | InChI=1S/C22H29N3O3/c1-27-20-11-8-16(14-21(20)28-2)12-13-23-18-9-10-19(24-15-18)22(26)25-17-6-4-3-5-7-17/h8-11,14-15,17,23H,3-7,12-13H2,1-2H3,(H,25,26) |
| InChIKey | BLMXXHWIFPUQDL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |