C17H22N4O3 — CID 109270813
5-[(3,4-dimethoxyphenyl)methylamino]-N-propylpyrazine-2-carboxamide (PubChem CID 109270813) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 5-[(3,4-dimethoxyphenyl)methylamino]-N-propylpyrazine-2-carboxamide.
| Compound Name | 5-[(3,4-dimethoxyphenyl)methylamino]-N-propylpyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109270813 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 5-[(3,4-dimethoxyphenyl)methylamino]-N-propylpyrazine-2-carboxamide |
| SMILES | CCCNC(=O)c1cnc(NCc2ccc(OC)c(OC)c2)cn1 |
| InChI | InChI=1S/C17H22N4O3/c1-4-7-18-17(22)13-10-21-16(11-19-13)20-9-12-5-6-14(23-2)15(8-12)24-3/h5-6,8,10-11H,4,7,9H2,1-3H3,(H,18,22)(H,20,21) |
| InChIKey | GLRPSWHDLXJTMI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |