C15H26N4O — CID 113044637
2-ethyl-N-[6-(pentylamino)pyridazin-3-yl]butanamide (PubChem CID 113044637) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-ethyl-N-[6-(pentylamino)pyridazin-3-yl]butanamide.
| Compound Name | 2-ethyl-N-[6-(pentylamino)pyridazin-3-yl]butanamide |
|---|---|
| PubChem CID | 113044637 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | 2-ethyl-N-[6-(pentylamino)pyridazin-3-yl]butanamide |
| SMILES | CCCCCNc1ccc(NC(=O)C(CC)CC)nn1 |
| InChI | InChI=1S/C15H26N4O/c1-4-7-8-11-16-13-9-10-14(19-18-13)17-15(20)12(5-2)6-3/h9-10,12H,4-8,11H2,1-3H3,(H,16,18)(H,17,19,20) |
| InChIKey | JIOTVVOVVPHQLM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|