C25H25N3O4 — CID 143250191
6-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenoxy]-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine (PubChem CID 143250191) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 6-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenoxy]-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine.
| Compound Name | 6-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenoxy]-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 143250191 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 6-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenoxy]-N-(3,4,5-trimethoxyphenyl)pyrazin-2-amine |
| SMILES | C=C/C=C(\C=C)c1ccc(Oc2cncc(Nc3cc(OC)c(OC)c(OC)c3)n2)cc1 |
| InChI | InChI=1S/C25H25N3O4/c1-6-8-17(7-2)18-9-11-20(12-10-18)32-24-16-26-15-23(28-24)27-19-13-21(29-3)25(31-5)22(14-19)30-4/h6-16H,1-2H2,3-5H3,(H,27,28)/b17-8+ |
| InChIKey | PDROYULINQMEHB-CAOOACKPSA-N |
| XLogP | 5.79 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|