C18H15F3N4O — CID 112860328
6-N-[(4-methoxyphenyl)methyl]-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine (PubChem CID 112860328) has the molecular formula C18H15F3N4O and a molecular weight of 360.34 g/mol. Its IUPAC name is 6-N-[(4-methoxyphenyl)methyl]-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-[(4-methoxyphenyl)methyl]-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112860328 |
| Molecular Formula | C18H15F3N4O |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 6-N-[(4-methoxyphenyl)methyl]-4-N-(2,3,4-trifluorophenyl)pyrimidine-4,6-diamine |
| SMILES | COc1ccc(CNc2cc(Nc3ccc(F)c(F)c3F)ncn2)cc1 |
| InChI | InChI=1S/C18H15F3N4O/c1-26-12-4-2-11(3-5-12)9-22-15-8-16(24-10-23-15)25-14-7-6-13(19)17(20)18(14)21/h2-8,10H,9H2,1H3,(H2,22,23,24,25) |
| InChIKey | YRUVKVJCLFQLJJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|