C14H12Cl2N4O — CID 109339596
N-(2,6-dichlorophenyl)-6-(prop-2-enylamino)pyrimidine-4-carboxamide (PubChem CID 109339596) has the molecular formula C14H12Cl2N4O and a molecular weight of 323.18 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-6-(prop-2-enylamino)pyrimidine-4-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-6-(prop-2-enylamino)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 109339596 |
| Molecular Formula | C14H12Cl2N4O |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | N-(2,6-dichlorophenyl)-6-(prop-2-enylamino)pyrimidine-4-carboxamide |
| SMILES | C=CCNc1cc(C(=O)Nc2c(Cl)cccc2Cl)ncn1 |
| InChI | InChI=1S/C14H12Cl2N4O/c1-2-6-17-12-7-11(18-8-19-12)14(21)20-13-9(15)4-3-5-10(13)16/h2-5,7-8H,1,6H2,(H,20,21)(H,17,18,19) |
| InChIKey | PVEWYTYXASMAKV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|