C17H19ClN4OS2 — CID 71802605
N-(3-chloro-4-methylphenyl)-2-(6-thiomorpholin-4-ylpyrimidin-4-yl)sulfanylacetamide (PubChem CID 71802605) has the molecular formula C17H19ClN4OS2 and a molecular weight of 394.95 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2-(6-thiomorpholin-4-ylpyrimidin-4-yl)sulfanylacetamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-2-(6-thiomorpholin-4-ylpyrimidin-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 71802605 |
| Molecular Formula | C17H19ClN4OS2 |
| Molecular Weight | 394.95 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2-(6-thiomorpholin-4-ylpyrimidin-4-yl)sulfanylacetamide |
| SMILES | Cc1ccc(NC(=O)CSc2cc(N3CCSCC3)ncn2)cc1Cl |
| InChI | InChI=1S/C17H19ClN4OS2/c1-12-2-3-13(8-14(12)18)21-16(23)10-25-17-9-15(19-11-20-17)22-4-6-24-7-5-22/h2-3,8-9,11H,4-7,10H2,1H3,(H,21,23) |
| InChIKey | HCRUPMFCSFHWQA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.95 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |