C18H21FN4OS — CID 53136600
N-(4-fluorophenyl)-2-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]sulfanylacetamide (PubChem CID 53136600) has the molecular formula C18H21FN4OS and a molecular weight of 360.46 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]sulfanylacetamide.
| Compound Name | N-(4-fluorophenyl)-2-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 53136600 |
| Molecular Formula | C18H21FN4OS |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-(4-fluorophenyl)-2-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]sulfanylacetamide |
| SMILES | CC1CCN(c2cc(SCC(=O)Nc3ccc(F)cc3)ncn2)CC1 |
| InChI | InChI=1S/C18H21FN4OS/c1-13-6-8-23(9-7-13)16-10-18(21-12-20-16)25-11-17(24)22-15-4-2-14(19)3-5-15/h2-5,10,12-13H,6-9,11H2,1H3,(H,22,24) |
| InChIKey | ABHHZVPWNNCVII-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |