C13H16N6OS — CID 61296037
N-(3-amino-2-methylphenyl)-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide (PubChem CID 61296037) has the molecular formula C13H16N6OS and a molecular weight of 304.38 g/mol. Its IUPAC name is N-(3-amino-2-methylphenyl)-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-(3-amino-2-methylphenyl)-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 61296037 |
| Molecular Formula | C13H16N6OS |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-(3-amino-2-methylphenyl)-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide |
| SMILES | Cc1c(N)cccc1NC(=O)CSc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C13H16N6OS/c1-7-8(14)3-2-4-9(7)17-12(20)6-21-13-18-10(15)5-11(16)19-13/h2-5H,6,14H2,1H3,(H,17,20)(H4,15,16,18,19) |
| InChIKey | YVCJMQNPLVXQGI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 132.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|