C16H21N5OS — CID 863621
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2,6-diethylphenyl)acetamide (PubChem CID 863621) has the molecular formula C16H21N5OS and a molecular weight of 331.45 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2,6-diethylphenyl)acetamide.
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2,6-diethylphenyl)acetamide |
|---|---|
| PubChem CID | 863621 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2,6-diethylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1NC(=O)CSc1nc(N)cc(N)n1 |
| InChI | InChI=1S/C16H21N5OS/c1-3-10-6-5-7-11(4-2)15(10)21-14(22)9-23-16-19-12(17)8-13(18)20-16/h5-8H,3-4,9H2,1-2H3,(H,21,22)(H4,17,18,19,20) |
| InChIKey | XEWVRZPPGLVWDU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |