C12H16N2O3S — CID 43618012
methyl 2-[2-(3-amino-2-methylanilino)-2-oxoethyl]sulfanylacetate (PubChem CID 43618012) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is methyl 2-[2-(3-amino-2-methylanilino)-2-oxoethyl]sulfanylacetate.
| Compound Name | methyl 2-[2-(3-amino-2-methylanilino)-2-oxoethyl]sulfanylacetate |
|---|---|
| PubChem CID | 43618012 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | methyl 2-[2-(3-amino-2-methylanilino)-2-oxoethyl]sulfanylacetate |
| SMILES | COC(=O)CSCC(=O)Nc1cccc(N)c1C |
| InChI | InChI=1S/C12H16N2O3S/c1-8-9(13)4-3-5-10(8)14-11(15)6-18-7-12(16)17-2/h3-5H,6-7,13H2,1-2H3,(H,14,15) |
| InChIKey | VYPVMBKGSZYNQW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|