C13H18N2O5S — CID 43618125
methyl 2-[3-(3-amino-2-methylanilino)-3-oxopropyl]sulfonylacetate (PubChem CID 43618125) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is methyl 2-[3-(3-amino-2-methylanilino)-3-oxopropyl]sulfonylacetate.
| Compound Name | methyl 2-[3-(3-amino-2-methylanilino)-3-oxopropyl]sulfonylacetate |
|---|---|
| PubChem CID | 43618125 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | methyl 2-[3-(3-amino-2-methylanilino)-3-oxopropyl]sulfonylacetate |
| SMILES | COC(=O)CS(=O)(=O)CCC(=O)Nc1cccc(N)c1C |
| InChI | InChI=1S/C13H18N2O5S/c1-9-10(14)4-3-5-11(9)15-12(16)6-7-21(18,19)8-13(17)20-2/h3-5H,6-8,14H2,1-2H3,(H,15,16) |
| InChIKey | XQCQSABZOPJZNN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|