C17H11F3N2O2 — CID 4280823
2-(3-formylindol-1-yl)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 4280823) has the molecular formula C17H11F3N2O2 and a molecular weight of 332.28 g/mol. Its IUPAC name is 2-(3-formylindol-1-yl)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(3-formylindol-1-yl)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 4280823 |
| Molecular Formula | C17H11F3N2O2 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-(3-formylindol-1-yl)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=Cc1cn(CC(=O)Nc2ccc(F)c(F)c2F)c2ccccc12 |
| InChI | InChI=1S/C17H11F3N2O2/c18-12-5-6-13(17(20)16(12)19)21-15(24)8-22-7-10(9-23)11-3-1-2-4-14(11)22/h1-7,9H,8H2,(H,21,24) |
| InChIKey | FRKVMVSNSGENSI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|