C23H24N2O3 — CID 161125669
acetaldehyde;acetylene;2-(3-formylindol-1-yl)-N-[(4-methylphenyl)methyl]acetamide (PubChem CID 161125669) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is acetaldehyde;acetylene;2-(3-formylindol-1-yl)-N-[(4-methylphenyl)methyl]acetamide.
| Compound Name | acetaldehyde;acetylene;2-(3-formylindol-1-yl)-N-[(4-methylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 161125669 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | acetaldehyde;acetylene;2-(3-formylindol-1-yl)-N-[(4-methylphenyl)methyl]acetamide |
| SMILES | C#C.CC=O.Cc1ccc(CNC(=O)Cn2cc(C=O)c3ccccc32)cc1 |
| InChI | InChI=1S/C19H18N2O2.C2H4O.C2H2/c1-14-6-8-15(9-7-14)10-20-19(23)12-21-11-16(13-22)17-4-2-3-5-18(17)21;1-2-3;1-2/h2-9,11,13H,10,12H2,1H3,(H,20,23);2H,1H3;1-2H |
| InChIKey | ULNHNQVNCNBJOU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|