C11H13ClN2O5S2 — CID 104569450
2-[2-[3-chloro-4-(methanesulfonamido)anilino]-2-oxoethyl]sulfanylacetic acid (PubChem CID 104569450) has the molecular formula C11H13ClN2O5S2 and a molecular weight of 352.82 g/mol. Its IUPAC name is 2-[2-[3-chloro-4-(methanesulfonamido)anilino]-2-oxoethyl]sulfanylacetic acid.
| Compound Name | 2-[2-[3-chloro-4-(methanesulfonamido)anilino]-2-oxoethyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 104569450 |
| Molecular Formula | C11H13ClN2O5S2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 2-[2-[3-chloro-4-(methanesulfonamido)anilino]-2-oxoethyl]sulfanylacetic acid |
| SMILES | CS(=O)(=O)Nc1ccc(NC(=O)CSCC(=O)O)cc1Cl |
| InChI | InChI=1S/C11H13ClN2O5S2/c1-21(18,19)14-9-3-2-7(4-8(9)12)13-10(15)5-20-6-11(16)17/h2-4,14H,5-6H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | QQRNOXDKZHAVSA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |