C13H20ClN3O3S — CID 81070770
3-(aminomethyl)-N-[3-chloro-4-(methanesulfonamido)phenyl]pentanamide (PubChem CID 81070770) has the molecular formula C13H20ClN3O3S and a molecular weight of 333.84 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[3-chloro-4-(methanesulfonamido)phenyl]pentanamide.
| Compound Name | 3-(aminomethyl)-N-[3-chloro-4-(methanesulfonamido)phenyl]pentanamide |
|---|---|
| PubChem CID | 81070770 |
| Molecular Formula | C13H20ClN3O3S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 3-(aminomethyl)-N-[3-chloro-4-(methanesulfonamido)phenyl]pentanamide |
| SMILES | CCC(CN)CC(=O)Nc1ccc(NS(C)(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClN3O3S/c1-3-9(8-15)6-13(18)16-10-4-5-12(11(14)7-10)17-21(2,19)20/h4-5,7,9,17H,3,6,8,15H2,1-2H3,(H,16,18) |
| InChIKey | QKXYFSMHBMCPNW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |