C12H18ClN3O3S — CID 81076100
4-amino-N-[3-chloro-4-(methanesulfonamido)phenyl]-3-methylbutanamide (PubChem CID 81076100) has the molecular formula C12H18ClN3O3S and a molecular weight of 319.81 g/mol. Its IUPAC name is 4-amino-N-[3-chloro-4-(methanesulfonamido)phenyl]-3-methylbutanamide.
| Compound Name | 4-amino-N-[3-chloro-4-(methanesulfonamido)phenyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 81076100 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4-amino-N-[3-chloro-4-(methanesulfonamido)phenyl]-3-methylbutanamide |
| SMILES | CC(CN)CC(=O)Nc1ccc(NS(C)(=O)=O)c(Cl)c1 |
| InChI | InChI=1S/C12H18ClN3O3S/c1-8(7-14)5-12(17)15-9-3-4-11(10(13)6-9)16-20(2,18)19/h3-4,6,8,16H,5,7,14H2,1-2H3,(H,15,17) |
| InChIKey | RKZVXMMAFVTBPW-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |