C22H36N3O3S+ — CID 11931281
2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-[5-(diethylsulfamoyl)-2-methylphenyl]acetamide (PubChem CID 11931281) has the molecular formula C22H36N3O3S+ and a molecular weight of 422.62 g/mol. Its IUPAC name is 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-[5-(diethylsulfamoyl)-2-methylphenyl]acetamide.
| Compound Name | 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-[5-(diethylsulfamoyl)-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 11931281 |
| Molecular Formula | C22H36N3O3S+ |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 2-[(4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-[5-(diethylsulfamoyl)-2-methylphenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C)c(NC(=O)C[NH+]2CCC[C@H]3CCCC[C@@H]32)c1 |
| InChI | InChI=1S/C22H35N3O3S/c1-4-25(5-2)29(27,28)19-13-12-17(3)20(15-19)23-22(26)16-24-14-8-10-18-9-6-7-11-21(18)24/h12-13,15,18,21H,4-11,14,16H2,1-3H3,(H,23,26)/p+1/t18-,21+/m1/s1 |
| InChIKey | WRGHQUYLOPSOJU-NQIIRXRSSA-O |
| XLogP | 2.20 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |