C19H29ClN3O3S+ — CID 11931581
2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-[2-chloro-5-(dimethylsulfamoyl)phenyl]acetamide (PubChem CID 11931581) has the molecular formula C19H29ClN3O3S+ and a molecular weight of 414.98 g/mol. Its IUPAC name is 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-[2-chloro-5-(dimethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-[2-chloro-5-(dimethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 11931581 |
| Molecular Formula | C19H29ClN3O3S+ |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-[(4aS,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium-1-yl]-N-[2-chloro-5-(dimethylsulfamoyl)phenyl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(Cl)c(NC(=O)C[NH+]2CCC[C@@H]3CCCC[C@@H]32)c1 |
| InChI | InChI=1S/C19H28ClN3O3S/c1-22(2)27(25,26)15-9-10-16(20)17(12-15)21-19(24)13-23-11-5-7-14-6-3-4-8-18(14)23/h9-10,12,14,18H,3-8,11,13H2,1-2H3,(H,21,24)/p+1/t14-,18-/m0/s1 |
| InChIKey | GDYQUJONGOGHLX-KSSFIOAISA-O |
| XLogP | 1.77 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |