C17H28ClN3O4S — CID 120631843
(2S,4S)-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-methylpiperidine-4-carboxamide;hydrochloride (PubChem CID 120631843) has the molecular formula C17H28ClN3O4S and a molecular weight of 405.95 g/mol. Its IUPAC name is (2S,4S)-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-methylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | (2S,4S)-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-methylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120631843 |
| Molecular Formula | C17H28ClN3O4S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (2S,4S)-N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2-methylpiperidine-4-carboxamide;hydrochloride |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)[C@H]2CCN[C@@H](C)C2)c1.Cl |
| InChI | InChI=1S/C17H27N3O4S.ClH/c1-4-20(5-2)25(23,24)14-6-7-16(21)15(11-14)19-17(22)13-8-9-18-12(3)10-13;/h6-7,11-13,18,21H,4-5,8-10H2,1-3H3,(H,19,22);1H/t12-,13-;/m0./s1 |
| InChIKey | ZSVABHKRCFVKBT-QNTKWALQSA-N |
| XLogP | 2.17 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|