C20H30N2O4S — CID 18149059
N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide (PubChem CID 18149059) has the molecular formula C20H30N2O4S and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 18149059 |
| Molecular Formula | C20H30N2O4S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(O)c(NC(=O)C2C(C=C(C)C)C2(C)C)c1 |
| InChI | InChI=1S/C20H30N2O4S/c1-7-22(8-2)27(25,26)14-9-10-17(23)16(12-14)21-19(24)18-15(11-13(3)4)20(18,5)6/h9-12,15,18,23H,7-8H2,1-6H3,(H,21,24) |
| InChIKey | IKYGBRMPQZIIRN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|