C15H22N3O3+ — CID 7409447
N-(2-methyl-4-nitrophenyl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]acetamide (PubChem CID 7409447) has the molecular formula C15H22N3O3+ and a molecular weight of 292.36 g/mol. Its IUPAC name is N-(2-methyl-4-nitrophenyl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-methyl-4-nitrophenyl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 7409447 |
| Molecular Formula | C15H22N3O3+ |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | N-(2-methyl-4-nitrophenyl)-2-[(3R)-3-methylpiperidin-1-ium-1-yl]acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)C[NH+]1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C15H21N3O3/c1-11-4-3-7-17(9-11)10-15(19)16-14-6-5-13(18(20)21)8-12(14)2/h5-6,8,11H,3-4,7,9-10H2,1-2H3,(H,16,19)/p+1/t11-/m1/s1 |
| InChIKey | FNGAWZJRTXWCCS-LLVKDONJSA-O |
| XLogP | 1.16 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|