C15H22N3O4+ — CID 2653505
2-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(2-methyl-5-nitrophenyl)acetamide (PubChem CID 2653505) has the molecular formula C15H22N3O4+ and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(2-methyl-5-nitrophenyl)acetamide.
| Compound Name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(2-methyl-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2653505 |
| Molecular Formula | C15H22N3O4+ |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 2-[(2S,6S)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(2-methyl-5-nitrophenyl)acetamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)C[NH+]1C[C@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C15H21N3O4/c1-10-4-5-13(18(20)21)6-14(10)16-15(19)9-17-7-11(2)22-12(3)8-17/h4-6,11-12H,7-9H2,1-3H3,(H,16,19)/p+1/t11-,12-/m0/s1 |
| InChIKey | JNLIMDSTFTXPFY-RYUDHWBXSA-O |
| XLogP | 0.53 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|