C16H24N3O4+ — CID 8900026
2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(4,5-dimethyl-2-nitrophenyl)acetamide (PubChem CID 8900026) has the molecular formula C16H24N3O4+ and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(4,5-dimethyl-2-nitrophenyl)acetamide.
| Compound Name | 2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(4,5-dimethyl-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 8900026 |
| Molecular Formula | C16H24N3O4+ |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-[(2R,6R)-2,6-dimethylmorpholin-4-ium-4-yl]-N-(4,5-dimethyl-2-nitrophenyl)acetamide |
| SMILES | Cc1cc(NC(=O)C[NH+]2C[C@@H](C)O[C@H](C)C2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C16H23N3O4/c1-10-5-14(15(19(21)22)6-11(10)2)17-16(20)9-18-7-12(3)23-13(4)8-18/h5-6,12-13H,7-9H2,1-4H3,(H,17,20)/p+1/t12-,13-/m1/s1 |
| InChIKey | JOWGBDYGLIWFIS-CHWSQXEVSA-O |
| XLogP | 0.84 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|