C10H8F2N4O3S — CID 63078897
N-(2,6-difluoro-4-sulfamoylphenyl)-1H-pyrazole-4-carboxamide (PubChem CID 63078897) has the molecular formula C10H8F2N4O3S and a molecular weight of 302.26 g/mol. Its IUPAC name is N-(2,6-difluoro-4-sulfamoylphenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(2,6-difluoro-4-sulfamoylphenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 63078897 |
| Molecular Formula | C10H8F2N4O3S |
| Molecular Weight | 302.26 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | N-(2,6-difluoro-4-sulfamoylphenyl)-1H-pyrazole-4-carboxamide |
| SMILES | NS(=O)(=O)c1cc(F)c(NC(=O)c2cn[nH]c2)c(F)c1 |
| InChI | InChI=1S/C10H8F2N4O3S/c11-7-1-6(20(13,18)19)2-8(12)9(7)16-10(17)5-3-14-15-4-5/h1-4H,(H,14,15)(H,16,17)(H2,13,18,19) |
| InChIKey | OGIPXAJZYGQORW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.26 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |