C11H11BrN4O — CID 116813556
N-(2-amino-6-bromo-4-methylphenyl)-1H-pyrazole-4-carboxamide (PubChem CID 116813556) has the molecular formula C11H11BrN4O and a molecular weight of 295.14 g/mol. Its IUPAC name is N-(2-amino-6-bromo-4-methylphenyl)-1H-pyrazole-4-carboxamide.
| Compound Name | N-(2-amino-6-bromo-4-methylphenyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 116813556 |
| Molecular Formula | C11H11BrN4O |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | N-(2-amino-6-bromo-4-methylphenyl)-1H-pyrazole-4-carboxamide |
| SMILES | Cc1cc(N)c(NC(=O)c2cn[nH]c2)c(Br)c1 |
| InChI | InChI=1S/C11H11BrN4O/c1-6-2-8(12)10(9(13)3-6)16-11(17)7-4-14-15-5-7/h2-5H,13H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | LDCIGEXQRRBOAR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|