C13H11BrFN3O — CID 116813696
N-(2-amino-6-bromo-4-methylphenyl)-5-fluoropyridine-2-carboxamide (PubChem CID 116813696) has the molecular formula C13H11BrFN3O and a molecular weight of 324.15 g/mol. Its IUPAC name is N-(2-amino-6-bromo-4-methylphenyl)-5-fluoropyridine-2-carboxamide.
| Compound Name | N-(2-amino-6-bromo-4-methylphenyl)-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 116813696 |
| Molecular Formula | C13H11BrFN3O |
| Molecular Weight | 324.15 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | N-(2-amino-6-bromo-4-methylphenyl)-5-fluoropyridine-2-carboxamide |
| SMILES | Cc1cc(N)c(NC(=O)c2ccc(F)cn2)c(Br)c1 |
| InChI | InChI=1S/C13H11BrFN3O/c1-7-4-9(14)12(10(16)5-7)18-13(19)11-3-2-8(15)6-17-11/h2-6H,16H2,1H3,(H,18,19) |
| InChIKey | FIOLXOPUYQUSCC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.15 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|