C12H11Br2N3O — CID 43643269
4-amino-N-(2,6-dibromo-4-methylphenyl)-1H-pyrrole-2-carboxamide (PubChem CID 43643269) has the molecular formula C12H11Br2N3O and a molecular weight of 373.05 g/mol. Its IUPAC name is 4-amino-N-(2,6-dibromo-4-methylphenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-amino-N-(2,6-dibromo-4-methylphenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43643269 |
| Molecular Formula | C12H11Br2N3O |
| Molecular Weight | 373.05 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | 4-amino-N-(2,6-dibromo-4-methylphenyl)-1H-pyrrole-2-carboxamide |
| SMILES | Cc1cc(Br)c(NC(=O)c2cc(N)c[nH]2)c(Br)c1 |
| InChI | InChI=1S/C12H11Br2N3O/c1-6-2-8(13)11(9(14)3-6)17-12(18)10-4-7(15)5-16-10/h2-5,16H,15H2,1H3,(H,17,18) |
| InChIKey | RBANOAKZAYBFIC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.05 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |