C11H8Cl3N3O — CID 43643281
4-amino-N-(2,4,6-trichlorophenyl)-1H-pyrrole-2-carboxamide (PubChem CID 43643281) has the molecular formula C11H8Cl3N3O and a molecular weight of 304.56 g/mol. Its IUPAC name is 4-amino-N-(2,4,6-trichlorophenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4-amino-N-(2,4,6-trichlorophenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43643281 |
| Molecular Formula | C11H8Cl3N3O |
| Molecular Weight | 304.56 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 4-amino-N-(2,4,6-trichlorophenyl)-1H-pyrrole-2-carboxamide |
| SMILES | Nc1c[nH]c(C(=O)Nc2c(Cl)cc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C11H8Cl3N3O/c12-5-1-7(13)10(8(14)2-5)17-11(18)9-3-6(15)4-16-9/h1-4,16H,15H2,(H,17,18) |
| InChIKey | JUVNPGVGFYTLQK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |