C12H14N2O7S — CID 168566714
dimethyl (E)-2-(2-hydroxy-5-sulfamoylanilino)but-2-enedioate (PubChem CID 168566714) has the molecular formula C12H14N2O7S and a molecular weight of 330.32 g/mol. Its IUPAC name is dimethyl (E)-2-(2-hydroxy-5-sulfamoylanilino)but-2-enedioate.
| Compound Name | dimethyl (E)-2-(2-hydroxy-5-sulfamoylanilino)but-2-enedioate |
|---|---|
| PubChem CID | 168566714 |
| Molecular Formula | C12H14N2O7S |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | dimethyl (E)-2-(2-hydroxy-5-sulfamoylanilino)but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(S(N)(=O)=O)ccc1O)C(=O)OC |
| InChI | InChI=1S/C12H14N2O7S/c1-20-11(16)6-9(12(17)21-2)14-8-5-7(22(13,18)19)3-4-10(8)15/h3-6,14-15H,1-2H3,(H2,13,18,19)/b9-6+ |
| InChIKey | RJOOEUZVCGFMMZ-RMKNXTFCSA-N |
| XLogP | -0.32 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|