C17H15ClF2N2O4S — CID 4803040
2-chloro-4,5-difluoro-N-(3-morpholin-4-ylsulfonylphenyl)benzamide (PubChem CID 4803040) has the molecular formula C17H15ClF2N2O4S and a molecular weight of 416.83 g/mol. Its IUPAC name is 2-chloro-4,5-difluoro-N-(3-morpholin-4-ylsulfonylphenyl)benzamide.
| Compound Name | 2-chloro-4,5-difluoro-N-(3-morpholin-4-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 4803040 |
| Molecular Formula | C17H15ClF2N2O4S |
| Molecular Weight | 416.83 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | 2-chloro-4,5-difluoro-N-(3-morpholin-4-ylsulfonylphenyl)benzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCOCC2)c1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C17H15ClF2N2O4S/c18-14-10-16(20)15(19)9-13(14)17(23)21-11-2-1-3-12(8-11)27(24,25)22-4-6-26-7-5-22/h1-3,8-10H,4-7H2,(H,21,23) |
| InChIKey | NYDDQZDRUSQBLK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.83 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|