C19H11BrClF2NOS — CID 2116645
N-[4-(4-bromophenyl)sulfanylphenyl]-2-chloro-4,5-difluorobenzamide (PubChem CID 2116645) has the molecular formula C19H11BrClF2NOS and a molecular weight of 454.72 g/mol. Its IUPAC name is N-[4-(4-bromophenyl)sulfanylphenyl]-2-chloro-4,5-difluorobenzamide.
| Compound Name | N-[4-(4-bromophenyl)sulfanylphenyl]-2-chloro-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 2116645 |
| Molecular Formula | C19H11BrClF2NOS |
| Molecular Weight | 454.72 g/mol |
| Exact Mass | 452.94 |
| IUPAC Name | N-[4-(4-bromophenyl)sulfanylphenyl]-2-chloro-4,5-difluorobenzamide |
| SMILES | O=C(Nc1ccc(Sc2ccc(Br)cc2)cc1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C19H11BrClF2NOS/c20-11-1-5-13(6-2-11)26-14-7-3-12(4-8-14)24-19(25)15-9-17(22)18(23)10-16(15)21/h1-10H,(H,24,25) |
| InChIKey | SKZHOYQWPQSAQA-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.72 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|